C16H17N5O3 — CID 99948662
2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]acetamide (PubChem CID 99948662) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 99948662 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[[4-(2-methylimidazol-1-yl)phenyl]methyl]acetamide |
| SMILES | Cc1nccn1-c1ccc(CNC(=O)C[C@H]2NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C16H17N5O3/c1-10-17-6-7-21(10)12-4-2-11(3-5-12)9-18-14(22)8-13-15(23)20-16(24)19-13/h2-7,13H,8-9H2,1H3,(H,18,22)(H2,19,20,23,24)/t13-/m1/s1 |
| InChIKey | FSWDNEAHWHLPLP-CYBMUJFWSA-N |
| XLogP | 0.40 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|