C13H9Cl6NO2 — CID 99949024
(1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-(2-methylprop-2-enyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 99949024) has the molecular formula C13H9Cl6NO2 and a molecular weight of 423.94 g/mol. Its IUPAC name is (1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-(2-methylprop-2-enyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-(2-methylprop-2-enyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 99949024 |
| Molecular Formula | C13H9Cl6NO2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 420.88 |
| IUPAC Name | (1R,2S,6S,7R)-1,7,8,9,10,10-hexachloro-4-(2-methylprop-2-enyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | C=C(C)CN1C(=O)[C@@H]2[C@@H](C1=O)[C@@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C13H9Cl6NO2/c1-4(2)3-20-9(21)5-6(10(20)22)12(17)8(15)7(14)11(5,16)13(12,18)19/h5-6H,1,3H2,2H3/t5-,6-,11+,12+/m0/s1 |
| InChIKey | LLCVPGVGOZPLLQ-KUGABMNMSA-N |
| XLogP | 4.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|