C10H2Cl8O3 — CID 99951155
(1S,2S,6S,7S)-1,2,4,5,6,7,8,9-octachloro-10,10-dihydroxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 99951155) has the molecular formula C10H2Cl8O3 and a molecular weight of 453.75 g/mol. Its IUPAC name is (1S,2S,6S,7S)-1,2,4,5,6,7,8,9-octachloro-10,10-dihydroxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2S,6S,7S)-1,2,4,5,6,7,8,9-octachloro-10,10-dihydroxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 99951155 |
| Molecular Formula | C10H2Cl8O3 |
| Molecular Weight | 453.75 g/mol |
| Exact Mass | 449.75 |
| IUPAC Name | (1S,2S,6S,7S)-1,2,4,5,6,7,8,9-octachloro-10,10-dihydroxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C(Cl)=C(Cl)[C@@]2(Cl)[C@@]1(Cl)[C@@]1(Cl)C(Cl)=C(Cl)[C@@]2(Cl)C1(O)O |
| InChI | InChI=1S/C10H2Cl8O3/c11-1-2(12)6(15)7(16)3(13)4(14)8(17,10(7,20)21)9(6,18)5(1)19/h20-21H/t6-,7-,8-,9+/m0/s1 |
| InChIKey | YYBHXXWZEXYZIP-XSPKLOCKSA-N |
| XLogP | 3.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|