C14H21N5O3 — CID 99954223
2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]acetamide (PubChem CID 99954223) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]acetamide.
| Compound Name | 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 99954223 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-[(4R)-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]acetamide |
| SMILES | CCc1c(C)nn(CCNC(=O)C[C@H]2NC(=O)NC2=O)c1C |
| InChI | InChI=1S/C14H21N5O3/c1-4-10-8(2)18-19(9(10)3)6-5-15-12(20)7-11-13(21)17-14(22)16-11/h11H,4-7H2,1-3H3,(H,15,20)(H2,16,17,21,22)/t11-/m1/s1 |
| InChIKey | PIOLGEKIUHLNNR-LLVKDONJSA-N |
| XLogP | -0.22 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|