C13H20BrN5S — CID 999588
3-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 999588) has the molecular formula C13H20BrN5S and a molecular weight of 358.31 g/mol. Its IUPAC name is 3-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 999588 |
| Molecular Formula | C13H20BrN5S |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]-4-(2-methylpropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nn(CCc2n[nH]c(=S)n2CC(C)C)c(C)c1Br |
| InChI | InChI=1S/C13H20BrN5S/c1-8(2)7-18-11(15-16-13(18)20)5-6-19-10(4)12(14)9(3)17-19/h8H,5-7H2,1-4H3,(H,16,20) |
| InChIKey | UWAYIQCHVWHPHE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|