About (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine
(4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine (PubChem CID 99958857) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine.
Molecular Properties
| Compound Name | (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine |
| PubChem CID | 99958857 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine |
| SMILES | CN(Cc1cccc2cc[nH]c12)[C@@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C17H24N2O/c1-17(2)11-15(8-10-20-17)19(3)12-14-6-4-5-13-7-9-18-16(13)14/h4-7,9,15,18H,8,10-12H2,1-3H3/t15-/m1/s1 |
| InChIKey | JQVYUNQVHJGIBP-OAHLLOKOSA-N |
| XLogP | 3.56 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine?
The IUPAC name of (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine (CID 99958857) is (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine.
What is the SMILES notation for (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine?
The canonical SMILES for (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine is CN(Cc1cccc2cc[nH]c12)[C@@H]1CCOC(C)(C)C1.
What is the InChIKey of (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine?
The InChIKey is JQVYUNQVHJGIBP-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H24N2O/c1-17(2)11-15(8-10-20-17)19(3)12-14-6-4-5-13-7-9-18-16(13)14/h4-7,9,15,18H,8,10-12H2,1-3H3/t15-/m1/s1.
What are the key properties of (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine?
(4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine has a molecular weight of 272.39 g/mol, XLogP of 3.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-N-(1H-indol-7-ylmethyl)-N,2,2-trimethyloxan-4-amine is sourced from PubChem (CID 99958857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).