About 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea
1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea (PubChem CID 999614) has the molecular formula C15H18BrN5OS
and a molecular weight of 396.31 g/mol. Its IUPAC name is 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea.
Molecular Properties
| Compound Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea |
| PubChem CID | 999614 |
| Molecular Formula | C15H18BrN5OS |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea |
| SMILES | Cc1nn(CCC(=O)NNC(=S)Nc2ccccc2)c(C)c1Br |
| InChI | InChI=1S/C15H18BrN5OS/c1-10-14(16)11(2)21(20-10)9-8-13(22)18-19-15(23)17-12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3,(H,18,22)(H2,17,19,23) |
| InChIKey | VJCNJYJCDMEUPI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea?
The IUPAC name of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea (CID 999614) is 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea.
What is the SMILES notation for 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea?
The canonical SMILES for 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea is Cc1nn(CCC(=O)NNC(=S)Nc2ccccc2)c(C)c1Br.
What is the InChIKey of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea?
The InChIKey is VJCNJYJCDMEUPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrN5OS/c1-10-14(16)11(2)21(20-10)9-8-13(22)18-19-15(23)17-12-6-4-3-5-7-12/h3-7H,8-9H2,1-2H3,(H,18,22)(H2,17,19,23).
What are the key properties of 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea?
1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea has a molecular weight of 396.31 g/mol, XLogP of 2.67, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propanoylamino]-3-phenylthiourea is sourced from PubChem (CID 999614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).