C26H23NO3S — CID 99962039
(1R,2R,3S,10S,11R,12R)-3,10-diphenyl-17-oxa-13λ6-thia-16-azapentacyclo[10.2.2.13,10.02,11.04,9]heptadeca-4,6,8-triene 13,13-dioxide (PubChem CID 99962039) has the molecular formula C26H23NO3S and a molecular weight of 429.54 g/mol. Its IUPAC name is (1R,2R,3S,10S,11R,12R)-3,10-diphenyl-17-oxa-13λ6-thia-16-azapentacyclo[10.2.2.13,10.02,11.04,9]heptadeca-4,6,8-triene 13,13-dioxide.
| Compound Name | (1R,2R,3S,10S,11R,12R)-3,10-diphenyl-17-oxa-13λ6-thia-16-azapentacyclo[10.2.2.13,10.02,11.04,9]heptadeca-4,6,8-triene 13,13-dioxide |
|---|---|
| PubChem CID | 99962039 |
| Molecular Formula | C26H23NO3S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (1R,2R,3S,10S,11R,12R)-3,10-diphenyl-17-oxa-13λ6-thia-16-azapentacyclo[10.2.2.13,10.02,11.04,9]heptadeca-4,6,8-triene 13,13-dioxide |
| SMILES | O=S1(=O)C[C@H]2CN[C@H]1[C@@H]1[C@@H]2[C@@]2(c3ccccc3)O[C@@]1(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C26H23NO3S/c28-31(29)16-17-15-27-24(31)23-22(17)25(18-9-3-1-4-10-18)20-13-7-8-14-21(20)26(23,30-25)19-11-5-2-6-12-19/h1-14,17,22-24,27H,15-16H2/t17-,22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | FEFYYVWOHFNCLG-LQHRYAOZSA-N |
| XLogP | 3.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |