C17H12N2O4 — CID 99963175
2-[(6aR)-5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl]acetic acid (PubChem CID 99963175) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-[(6aR)-5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl]acetic acid.
| Compound Name | 2-[(6aR)-5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl]acetic acid |
|---|---|
| PubChem CID | 99963175 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-[(6aR)-5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)c2ccccc2N2C(=O)c3ccccc3[C@H]12 |
| InChI | InChI=1S/C17H12N2O4/c20-14(21)9-18-15-10-5-1-2-6-11(10)17(23)19(15)13-8-4-3-7-12(13)16(18)22/h1-8,15H,9H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | HNTOTWWKNIDZSN-OAHLLOKOSA-N |
| XLogP | 1.89 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |