C8H15NO — CID 99963912
[(2S,3R)-2-prop-1-en-2-yloxolan-3-yl]methanamine (PubChem CID 99963912) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is [(2S,3R)-2-prop-1-en-2-yloxolan-3-yl]methanamine.
| Compound Name | [(2S,3R)-2-prop-1-en-2-yloxolan-3-yl]methanamine |
|---|---|
| PubChem CID | 99963912 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | [(2S,3R)-2-prop-1-en-2-yloxolan-3-yl]methanamine |
| SMILES | C=C(C)[C@H]1OCC[C@@H]1CN |
| InChI | InChI=1S/C8H15NO/c1-6(2)8-7(5-9)3-4-10-8/h7-8H,1,3-5,9H2,2H3/t7-,8-/m1/s1 |
| InChIKey | VILFIVXMIVVQPI-HTQZYQBOSA-N |
| XLogP | 0.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|