C14H15NOS — CID 99964806
1-(3-methylphenyl)-3-[(2S)-1,3-oxathiolan-2-yl]pyrrole (PubChem CID 99964806) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[(2S)-1,3-oxathiolan-2-yl]pyrrole.
| Compound Name | 1-(3-methylphenyl)-3-[(2S)-1,3-oxathiolan-2-yl]pyrrole |
|---|---|
| PubChem CID | 99964806 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1-(3-methylphenyl)-3-[(2S)-1,3-oxathiolan-2-yl]pyrrole |
| SMILES | Cc1cccc(-n2ccc([C@H]3OCCS3)c2)c1 |
| InChI | InChI=1S/C14H15NOS/c1-11-3-2-4-13(9-11)15-6-5-12(10-15)14-16-7-8-17-14/h2-6,9-10,14H,7-8H2,1H3/t14-/m0/s1 |
| InChIKey | CDWJKLRFBWELNI-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |