About (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine
(2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine (PubChem CID 99966748) has the molecular formula C17H17FN4O2
and a molecular weight of 328.35 g/mol. Its IUPAC name is (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine |
| PubChem CID | 99966748 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine |
| SMILES | Fc1ccccc1Cn1cc([C@@H]2OCCN2Cc2ccco2)nn1 |
| InChI | InChI=1S/C17H17FN4O2/c18-15-6-2-1-4-13(15)10-22-12-16(19-20-22)17-21(7-9-24-17)11-14-5-3-8-23-14/h1-6,8,12,17H,7,9-11H2/t17-/m0/s1 |
| InChIKey | HKEGAZDDOSQJTF-KRWDZBQOSA-N |
| XLogP | 2.59 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine?
The IUPAC name of (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine (CID 99966748) is (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine.
What is the SMILES notation for (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine?
The canonical SMILES for (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine is Fc1ccccc1Cn1cc([C@@H]2OCCN2Cc2ccco2)nn1.
What is the InChIKey of (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine?
The InChIKey is HKEGAZDDOSQJTF-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H17FN4O2/c18-15-6-2-1-4-13(15)10-22-12-16(19-20-22)17-21(7-9-24-17)11-14-5-3-8-23-14/h1-6,8,12,17H,7,9-11H2/t17-/m0/s1.
What are the key properties of (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine?
(2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine has a molecular weight of 328.35 g/mol, XLogP of 2.59, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[1-[(2-fluorophenyl)methyl]triazol-4-yl]-3-(furan-2-ylmethyl)-1,3-oxazolidine is sourced from PubChem (CID 99966748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).