C21H32N4O4S — CID 99967374
2-[cyclohexyl(methylsulfonyl)amino]-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]acetamide (PubChem CID 99967374) has the molecular formula C21H32N4O4S and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[cyclohexyl(methylsulfonyl)amino]-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]acetamide.
| Compound Name | 2-[cyclohexyl(methylsulfonyl)amino]-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 99967374 |
| Molecular Formula | C21H32N4O4S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[cyclohexyl(methylsulfonyl)amino]-N-[4-(4-methylpiperazine-1-carbonyl)phenyl]acetamide |
| SMILES | CN1CCN(C(=O)c2ccc(NC(=O)CN(C3CCCCC3)S(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C21H32N4O4S/c1-23-12-14-24(15-13-23)21(27)17-8-10-18(11-9-17)22-20(26)16-25(30(2,28)29)19-6-4-3-5-7-19/h8-11,19H,3-7,12-16H2,1-2H3,(H,22,26) |
| InChIKey | IXAQSWJZIGQBOG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |