C20H21IN2O — CID 99968142
2-(3-iodophenyl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-1,3-benzoxazole (PubChem CID 99968142) has the molecular formula C20H21IN2O and a molecular weight of 432.31 g/mol. Its IUPAC name is 2-(3-iodophenyl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-1,3-benzoxazole.
| Compound Name | 2-(3-iodophenyl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 99968142 |
| Molecular Formula | C20H21IN2O |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 2-(3-iodophenyl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-1,3-benzoxazole |
| SMILES | C[C@H]1CCCCN1Cc1ccc2oc(-c3cccc(I)c3)nc2c1 |
| InChI | InChI=1S/C20H21IN2O/c1-14-5-2-3-10-23(14)13-15-8-9-19-18(11-15)22-20(24-19)16-6-4-7-17(21)12-16/h4,6-9,11-12,14H,2-3,5,10,13H2,1H3/t14-/m0/s1 |
| InChIKey | LBYYUHPIBJSMIJ-AWEZNQCLSA-N |
| XLogP | 5.47 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|