C18H27FN2OS — CID 99969993
N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-2-(1-methylpiperidin-4-yl)acetamide (PubChem CID 99969993) has the molecular formula C18H27FN2OS and a molecular weight of 338.49 g/mol. Its IUPAC name is N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-2-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-2-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 99969993 |
| Molecular Formula | C18H27FN2OS |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-[3-[(4-fluorophenyl)methylsulfanyl]propyl]-2-(1-methylpiperidin-4-yl)acetamide |
| SMILES | CN1CCC(CC(=O)NCCCSCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H27FN2OS/c1-21-10-7-15(8-11-21)13-18(22)20-9-2-12-23-14-16-3-5-17(19)6-4-16/h3-6,15H,2,7-14H2,1H3,(H,20,22) |
| InChIKey | RIPWGOGPLLRDTJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|