C14H22N2O3S — CID 99971373
N-[[4-(1-methylpiperidin-4-yl)oxyphenyl]methyl]methanesulfonamide (PubChem CID 99971373) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N-[[4-(1-methylpiperidin-4-yl)oxyphenyl]methyl]methanesulfonamide.
| Compound Name | N-[[4-(1-methylpiperidin-4-yl)oxyphenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 99971373 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[[4-(1-methylpiperidin-4-yl)oxyphenyl]methyl]methanesulfonamide |
| SMILES | CN1CCC(Oc2ccc(CNS(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C14H22N2O3S/c1-16-9-7-14(8-10-16)19-13-5-3-12(4-6-13)11-15-20(2,17)18/h3-6,14-15H,7-11H2,1-2H3 |
| InChIKey | GVLLAIBLECRCDR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |