C18H21ClFN3O2S — CID 99971656
1-(2-chloro-6-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]methanesulfonamide (PubChem CID 99971656) has the molecular formula C18H21ClFN3O2S and a molecular weight of 397.90 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]methanesulfonamide.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 99971656 |
| Molecular Formula | C18H21ClFN3O2S |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-N-[4-(4-methylpiperazin-1-yl)phenyl]methanesulfonamide |
| SMILES | CN1CCN(c2ccc(NS(=O)(=O)Cc3c(F)cccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C18H21ClFN3O2S/c1-22-9-11-23(12-10-22)15-7-5-14(6-8-15)21-26(24,25)13-16-17(19)3-2-4-18(16)20/h2-8,21H,9-13H2,1H3 |
| InChIKey | YWHKRGDWIOQXEL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|