About 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide
3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide (PubChem CID 99972087) has the molecular formula C16H19Cl2N3O2
and a molecular weight of 356.25 g/mol. Its IUPAC name is 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide.
Molecular Properties
| Compound Name | 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide |
| PubChem CID | 99972087 |
| Molecular Formula | C16H19Cl2N3O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)N(C)[C@@H](C)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C16H19Cl2N3O2/c1-8-14(9(2)20-19-8)10(3)21(4)16(22)12-6-11(17)7-13(18)15(12)23-5/h6-7,10H,1-5H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | JGPFTLBUOXMTMC-JTQLQIEISA-N |
| XLogP | 4.18 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide?
The IUPAC name of 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide (CID 99972087) is 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide.
What is the SMILES notation for 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide?
The canonical SMILES for 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide is COc1c(Cl)cc(Cl)cc1C(=O)N(C)[C@@H](C)c1c(C)n[nH]c1C.
What is the InChIKey of 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide?
The InChIKey is JGPFTLBUOXMTMC-JTQLQIEISA-N. The full InChI is InChI=1S/C16H19Cl2N3O2/c1-8-14(9(2)20-19-8)10(3)21(4)16(22)12-6-11(17)7-13(18)15(12)23-5/h6-7,10H,1-5H3,(H,19,20)/t10-/m0/s1.
What are the key properties of 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide?
3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide has a molecular weight of 356.25 g/mol, XLogP of 4.18, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methoxy-N-methylbenzamide is sourced from PubChem (CID 99972087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).