About (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol
(6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol (PubChem CID 99972764) has the molecular formula C14H23ClN4O
and a molecular weight of 298.82 g/mol. Its IUPAC name is (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol.
Molecular Properties
| Compound Name | (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol |
| PubChem CID | 99972764 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol |
| SMILES | CN(C)CCN1CCN(c2ccc(Cl)cn2)C[C@@H](O)C1 |
| InChI | InChI=1S/C14H23ClN4O/c1-17(2)5-6-18-7-8-19(11-13(20)10-18)14-4-3-12(15)9-16-14/h3-4,9,13,20H,5-8,10-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | HPYMKGYGPYQAHG-ZDUSSCGKSA-N |
| XLogP | 0.78 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol?
The IUPAC name of (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol (CID 99972764) is (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol.
What is the SMILES notation for (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol?
The canonical SMILES for (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol is CN(C)CCN1CCN(c2ccc(Cl)cn2)C[C@@H](O)C1.
What is the InChIKey of (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol?
The InChIKey is HPYMKGYGPYQAHG-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H23ClN4O/c1-17(2)5-6-18-7-8-19(11-13(20)10-18)14-4-3-12(15)9-16-14/h3-4,9,13,20H,5-8,10-11H2,1-2H3/t13-/m0/s1.
What are the key properties of (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol?
(6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol has a molecular weight of 298.82 g/mol, XLogP of 0.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1-(5-chloro-2-pyridinyl)-4-[2-(dimethylamino)ethyl]-1,4-diazepan-6-ol is sourced from PubChem (CID 99972764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).