C19H22N2O — CID 99973517
1-[(3R)-3-(2-methylphenyl)piperidin-1-yl]-2-pyridin-2-ylethanone (PubChem CID 99973517) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[(3R)-3-(2-methylphenyl)piperidin-1-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[(3R)-3-(2-methylphenyl)piperidin-1-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 99973517 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-[(3R)-3-(2-methylphenyl)piperidin-1-yl]-2-pyridin-2-ylethanone |
| SMILES | Cc1ccccc1[C@H]1CCCN(C(=O)Cc2ccccn2)C1 |
| InChI | InChI=1S/C19H22N2O/c1-15-7-2-3-10-18(15)16-8-6-12-21(14-16)19(22)13-17-9-4-5-11-20-17/h2-5,7,9-11,16H,6,8,12-14H2,1H3/t16-/m0/s1 |
| InChIKey | GBSAAPUHZOHFDC-INIZCTEOSA-N |
| XLogP | 3.34 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |