About (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol
(6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol (PubChem CID 99974120) has the molecular formula C13H22FN5O
and a molecular weight of 283.35 g/mol. Its IUPAC name is (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol.
Molecular Properties
| Compound Name | (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol |
| PubChem CID | 99974120 |
| Molecular Formula | C13H22FN5O |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol |
| SMILES | CCCN1CCN(c2ncc(F)c(NC)n2)C[C@@H](O)C1 |
| InChI | InChI=1S/C13H22FN5O/c1-3-4-18-5-6-19(9-10(20)8-18)13-16-7-11(14)12(15-2)17-13/h7,10,20H,3-6,8-9H2,1-2H3,(H,15,16,17)/t10-/m0/s1 |
| InChIKey | OAZZJLVXADDKNZ-JTQLQIEISA-N |
| XLogP | 0.55 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol?
The IUPAC name of (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol (CID 99974120) is (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol.
What is the SMILES notation for (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol?
The canonical SMILES for (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol is CCCN1CCN(c2ncc(F)c(NC)n2)C[C@@H](O)C1.
What is the InChIKey of (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol?
The InChIKey is OAZZJLVXADDKNZ-JTQLQIEISA-N. The full InChI is InChI=1S/C13H22FN5O/c1-3-4-18-5-6-19(9-10(20)8-18)13-16-7-11(14)12(15-2)17-13/h7,10,20H,3-6,8-9H2,1-2H3,(H,15,16,17)/t10-/m0/s1.
What are the key properties of (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol?
(6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol has a molecular weight of 283.35 g/mol, XLogP of 0.55, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1-[5-fluoro-4-(methylamino)pyrimidin-2-yl]-4-propyl-1,4-diazepan-6-ol is sourced from PubChem (CID 99974120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).