C9H18N2O4S — CID 99975555
N-[2-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]ethyl]propanamide (PubChem CID 99975555) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is N-[2-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]ethyl]propanamide.
| Compound Name | N-[2-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 99975555 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N-[2-[[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]amino]ethyl]propanamide |
| SMILES | CCC(=O)NCCN[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C9H18N2O4S/c1-2-9(13)11-4-3-10-7-5-16(14,15)6-8(7)12/h7-8,10,12H,2-6H2,1H3,(H,11,13)/t7-,8-/m1/s1 |
| InChIKey | XYCMMKIFOHYXKA-HTQZYQBOSA-N |
| XLogP | -1.74 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|