About [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate
[(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate (PubChem CID 99976504) has the molecular formula C9H13Cl2NO5S
and a molecular weight of 318.18 g/mol. Its IUPAC name is [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate.
Molecular Properties
| Compound Name | [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate |
| PubChem CID | 99976504 |
| Molecular Formula | C9H13Cl2NO5S |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate |
| SMILES | CN(C(=O)CCl)[C@H]1CS(=O)(=O)C[C@H]1OC(=O)CCl |
| InChI | InChI=1S/C9H13Cl2NO5S/c1-12(8(13)2-10)6-4-18(15,16)5-7(6)17-9(14)3-11/h6-7H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | GXRZBTNGYRVSJN-NKWVEPMBSA-N |
| XLogP | -0.37 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate?
The IUPAC name of [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate (CID 99976504) is [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate.
What is the SMILES notation for [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate?
The canonical SMILES for [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate is CN(C(=O)CCl)[C@H]1CS(=O)(=O)C[C@H]1OC(=O)CCl.
What is the InChIKey of [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate?
The InChIKey is GXRZBTNGYRVSJN-NKWVEPMBSA-N. The full InChI is InChI=1S/C9H13Cl2NO5S/c1-12(8(13)2-10)6-4-18(15,16)5-7(6)17-9(14)3-11/h6-7H,2-5H2,1H3/t6-,7+/m0/s1.
What are the key properties of [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate?
[(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate has a molecular weight of 318.18 g/mol, XLogP of -0.37, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-[(2-chloroacetyl)-methylamino]-1,1-dioxothiolan-3-yl] 2-chloroacetate is sourced from PubChem (CID 99976504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).