About N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide
N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide (PubChem CID 99976981) has the molecular formula C5H9NO3S2
and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide.
Molecular Properties
| Compound Name | N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide |
| PubChem CID | 99976981 |
| Molecular Formula | C5H9NO3S2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide |
| SMILES | O=CN[C@H]1CS(=O)(=O)C[C@H]1S |
| InChI | InChI=1S/C5H9NO3S2/c7-3-6-4-1-11(8,9)2-5(4)10/h3-5,10H,1-2H2,(H,6,7)/t4-,5+/m0/s1 |
| InChIKey | LEFQWZNPCOQFBD-CRCLSJGQSA-N |
| XLogP | -1.17 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide?
The IUPAC name of N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide (CID 99976981) is N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide.
What is the SMILES notation for N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide?
The canonical SMILES for N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide is O=CN[C@H]1CS(=O)(=O)C[C@H]1S.
What is the InChIKey of N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide?
The InChIKey is LEFQWZNPCOQFBD-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H9NO3S2/c7-3-6-4-1-11(8,9)2-5(4)10/h3-5,10H,1-2H2,(H,6,7)/t4-,5+/m0/s1.
What are the key properties of N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide?
N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide has a molecular weight of 195.26 g/mol, XLogP of -1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4S)-1,1-dioxo-4-sulfanylthiolan-3-yl]formamide is sourced from PubChem (CID 99976981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).