About N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide
N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide (PubChem CID 99977037) has the molecular formula C10H19N3O6S2
and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide.
Molecular Properties
| Compound Name | N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide |
| PubChem CID | 99977037 |
| Molecular Formula | C10H19N3O6S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide |
| SMILES | O=CNCCN(C=O)CCNS(=O)(=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19N3O6S2/c14-8-11-2-4-13(9-15)5-3-12-21(18,19)10-1-6-20(16,17)7-10/h8-10,12H,1-7H2,(H,11,14)/t10-/m0/s1 |
| InChIKey | VASUKPIHWZYNBM-JTQLQIEISA-N |
| XLogP | -2.70 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide?
The IUPAC name of N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide (CID 99977037) is N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide.
What is the SMILES notation for N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide?
The canonical SMILES for N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide is O=CNCCN(C=O)CCNS(=O)(=O)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide?
The InChIKey is VASUKPIHWZYNBM-JTQLQIEISA-N. The full InChI is InChI=1S/C10H19N3O6S2/c14-8-11-2-4-13(9-15)5-3-12-21(18,19)10-1-6-20(16,17)7-10/h8-10,12H,1-7H2,(H,11,14)/t10-/m0/s1.
What are the key properties of N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide?
N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide has a molecular weight of 341.41 g/mol, XLogP of -2.70, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-[[(3S)-1,1-dioxothiolan-3-yl]sulfonylamino]ethyl-formylamino]ethyl]formamide is sourced from PubChem (CID 99977037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).