C19H25BN3O2- — CID 99977527
3-(4-methoxyphenyl)-4,4-dipropyl-1,3,5-triaza-4-boranuidabicyclo[4.4.0]deca-5,7,9-trien-2-one (PubChem CID 99977527) has the molecular formula C19H25BN3O2- and a molecular weight of 338.24 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4,4-dipropyl-1,3,5-triaza-4-boranuidabicyclo[4.4.0]deca-5,7,9-trien-2-one.
| Compound Name | 3-(4-methoxyphenyl)-4,4-dipropyl-1,3,5-triaza-4-boranuidabicyclo[4.4.0]deca-5,7,9-trien-2-one |
|---|---|
| PubChem CID | 99977527 |
| Molecular Formula | C19H25BN3O2- |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-(4-methoxyphenyl)-4,4-dipropyl-1,3,5-triaza-4-boranuidabicyclo[4.4.0]deca-5,7,9-trien-2-one |
| SMILES | CCC[B-]1(CCC)N=C2C=CC=CN2C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H25BN3O2/c1-4-13-20(14-5-2)21-18-8-6-7-15-22(18)19(24)23(20)16-9-11-17(25-3)12-10-16/h6-12,15H,4-5,13-14H2,1-3H3/q-1 |
| InChIKey | PARHKGZNDAVEEB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|