C6H8N2O4S — CID 99977629
(3aS,6aS)-2,5,5-trioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-3-carbaldehyde (PubChem CID 99977629) has the molecular formula C6H8N2O4S and a molecular weight of 204.21 g/mol. Its IUPAC name is (3aS,6aS)-2,5,5-trioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-3-carbaldehyde.
| Compound Name | (3aS,6aS)-2,5,5-trioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-3-carbaldehyde |
|---|---|
| PubChem CID | 99977629 |
| Molecular Formula | C6H8N2O4S |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | (3aS,6aS)-2,5,5-trioxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazole-3-carbaldehyde |
| SMILES | O=CN1C(=O)N[C@@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C6H8N2O4S/c9-3-8-5-2-13(11,12)1-4(5)7-6(8)10/h3-5H,1-2H2,(H,7,10)/t4-,5-/m1/s1 |
| InChIKey | LZGPNUZKKOYXLZ-RFZPGFLSSA-N |
| XLogP | -1.67 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|