C20H26N2O4S — CID 99979283
4-[[(2S)-pentan-2-yl]amino]-3-[[(1S)-1-phenylethyl]sulfamoyl]benzoic acid (PubChem CID 99979283) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-[[(2S)-pentan-2-yl]amino]-3-[[(1S)-1-phenylethyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[(2S)-pentan-2-yl]amino]-3-[[(1S)-1-phenylethyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 99979283 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 4-[[(2S)-pentan-2-yl]amino]-3-[[(1S)-1-phenylethyl]sulfamoyl]benzoic acid |
| SMILES | CCC[C@H](C)Nc1ccc(C(=O)O)cc1S(=O)(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O4S/c1-4-8-14(2)21-18-12-11-17(20(23)24)13-19(18)27(25,26)22-15(3)16-9-6-5-7-10-16/h5-7,9-15,21-22H,4,8H2,1-3H3,(H,23,24)/t14-,15-/m0/s1 |
| InChIKey | UNNDBXORVSFYOL-GJZGRUSLSA-N |
| XLogP | 4.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |