C13H16N6 — CID 99980102
6-piperazin-1-yl-N-pyridin-4-ylpyridazin-3-amine (PubChem CID 99980102) has the molecular formula C13H16N6 and a molecular weight of 256.31 g/mol. Its IUPAC name is 6-piperazin-1-yl-N-pyridin-4-ylpyridazin-3-amine.
| Compound Name | 6-piperazin-1-yl-N-pyridin-4-ylpyridazin-3-amine |
|---|---|
| PubChem CID | 99980102 |
| Molecular Formula | C13H16N6 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 6-piperazin-1-yl-N-pyridin-4-ylpyridazin-3-amine |
| SMILES | c1cc(Nc2ccc(N3CCNCC3)nn2)ccn1 |
| InChI | InChI=1S/C13H16N6/c1-2-13(19-9-7-15-8-10-19)18-17-12(1)16-11-3-5-14-6-4-11/h1-6,15H,7-10H2,(H,14,16,17) |
| InChIKey | ZXAUARAEFYSXGM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |