About N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine
N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 99980110) has the molecular formula C10H14N6
and a molecular weight of 218.26 g/mol. Its IUPAC name is N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine |
| PubChem CID | 99980110 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | Cc1nc(NCCN)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C10H14N6/c1-8-14-9(12-5-3-11)7-10(15-8)16-6-2-4-13-16/h2,4,6-7H,3,5,11H2,1H3,(H,12,14,15) |
| InChIKey | JPUGQJLKXIICHL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine?
The IUPAC name of N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine (CID 99980110) is N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine is Cc1nc(NCCN)cc(-n2cccn2)n1.
What is the InChIKey of N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine?
The InChIKey is JPUGQJLKXIICHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6/c1-8-14-9(12-5-3-11)7-10(15-8)16-6-2-4-13-16/h2,4,6-7H,3,5,11H2,1H3,(H,12,14,15).
What are the key properties of N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine?
N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine has a molecular weight of 218.26 g/mol, XLogP of 0.34, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 99980110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).