C12H18N2O3 — CID 99981473
(3R,4R)-3-(aminomethyl)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-4-ol (PubChem CID 99981473) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is (3R,4R)-3-(aminomethyl)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-4-ol.
| Compound Name | (3R,4R)-3-(aminomethyl)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-4-ol |
|---|---|
| PubChem CID | 99981473 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (3R,4R)-3-(aminomethyl)-6,7-dimethoxy-1,2,3,4-tetrahydroquinolin-4-ol |
| SMILES | COc1cc2c(cc1OC)[C@H](O)[C@H](CN)CN2 |
| InChI | InChI=1S/C12H18N2O3/c1-16-10-3-8-9(4-11(10)17-2)14-6-7(5-13)12(8)15/h3-4,7,12,14-15H,5-6,13H2,1-2H3/t7-,12-/m1/s1 |
| InChIKey | OJZVWNCJLNVASA-JMCQJSRRSA-N |
| XLogP | 0.74 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|