C15H22N2O5S — CID 99982592
5-(tert-butylsulfamoyl)-2-morpholin-4-ylbenzoic acid (PubChem CID 99982592) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-2-morpholin-4-ylbenzoic acid.
| Compound Name | 5-(tert-butylsulfamoyl)-2-morpholin-4-ylbenzoic acid |
|---|---|
| PubChem CID | 99982592 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-2-morpholin-4-ylbenzoic acid |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(N2CCOCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H22N2O5S/c1-15(2,3)16-23(20,21)11-4-5-13(12(10-11)14(18)19)17-6-8-22-9-7-17/h4-5,10,16H,6-9H2,1-3H3,(H,18,19) |
| InChIKey | CPYZVQJQENPQRK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |