About (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol
(6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol (PubChem CID 99982842) has the molecular formula C19H29N3O3
and a molecular weight of 347.46 g/mol. Its IUPAC name is (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol.
Molecular Properties
| Compound Name | (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol |
| PubChem CID | 99982842 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol |
| SMILES | Cc1cc2c(cc1CN1CCN(C3CCNCC3)C[C@@H](O)C1)OCO2 |
| InChI | InChI=1S/C19H29N3O3/c1-14-8-18-19(25-13-24-18)9-15(14)10-21-6-7-22(12-17(23)11-21)16-2-4-20-5-3-16/h8-9,16-17,20,23H,2-7,10-13H2,1H3/t17-/m0/s1 |
| InChIKey | NESCAIMGIDMNTP-KRWDZBQOSA-N |
| XLogP | 0.95 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol?
The IUPAC name of (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol (CID 99982842) is (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol.
What is the SMILES notation for (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol?
The canonical SMILES for (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol is Cc1cc2c(cc1CN1CCN(C3CCNCC3)C[C@@H](O)C1)OCO2.
What is the InChIKey of (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol?
The InChIKey is NESCAIMGIDMNTP-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H29N3O3/c1-14-8-18-19(25-13-24-18)9-15(14)10-21-6-7-22(12-17(23)11-21)16-2-4-20-5-3-16/h8-9,16-17,20,23H,2-7,10-13H2,1H3/t17-/m0/s1.
What are the key properties of (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol?
(6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol has a molecular weight of 347.46 g/mol, XLogP of 0.95, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1-[(6-methyl-1,3-benzodioxol-5-yl)methyl]-4-piperidin-4-yl-1,4-diazepan-6-ol is sourced from PubChem (CID 99982842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).