C24H22N2O4 — CID 99983508
(3aR,4R,8aR,8bS)-2-(4-acetylphenyl)-4-benzoyl-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 99983508) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is (3aR,4R,8aR,8bS)-2-(4-acetylphenyl)-4-benzoyl-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aR,4R,8aR,8bS)-2-(4-acetylphenyl)-4-benzoyl-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 99983508 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (3aR,4R,8aR,8bS)-2-(4-acetylphenyl)-4-benzoyl-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CCCN2[C@H]3C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O4/c1-14(27)15-9-11-17(12-10-15)26-23(29)19-18-8-5-13-25(18)21(20(19)24(26)30)22(28)16-6-3-2-4-7-16/h2-4,6-7,9-12,18-21H,5,8,13H2,1H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | GRQHNJFGNPBKRZ-XRXFAXGQSA-N |
| XLogP | 2.72 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|