About 2-cyclobutyl-4,5-diiodopyridazin-3-one
2-cyclobutyl-4,5-diiodopyridazin-3-one (PubChem CID 99983573) has the molecular formula C8H8I2N2O
and a molecular weight of 401.97 g/mol. Its IUPAC name is 2-cyclobutyl-4,5-diiodopyridazin-3-one.
Molecular Properties
| Compound Name | 2-cyclobutyl-4,5-diiodopyridazin-3-one |
| PubChem CID | 99983573 |
| Molecular Formula | C8H8I2N2O |
| Molecular Weight | 401.97 g/mol |
| Exact Mass | 401.87 |
| IUPAC Name | 2-cyclobutyl-4,5-diiodopyridazin-3-one |
| SMILES | O=c1c(I)c(I)cnn1C1CCC1 |
| InChI | InChI=1S/C8H8I2N2O/c9-6-4-11-12(5-2-1-3-5)8(13)7(6)10/h4-5H,1-3H2 |
| InChIKey | BDSMZWGQUNLHBO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.97 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclobutyl-4,5-diiodopyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-4,5-diiodopyridazin-3-one?
The IUPAC name of 2-cyclobutyl-4,5-diiodopyridazin-3-one (CID 99983573) is 2-cyclobutyl-4,5-diiodopyridazin-3-one.
What is the SMILES notation for 2-cyclobutyl-4,5-diiodopyridazin-3-one?
The canonical SMILES for 2-cyclobutyl-4,5-diiodopyridazin-3-one is O=c1c(I)c(I)cnn1C1CCC1.
What is the InChIKey of 2-cyclobutyl-4,5-diiodopyridazin-3-one?
The InChIKey is BDSMZWGQUNLHBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8I2N2O/c9-6-4-11-12(5-2-1-3-5)8(13)7(6)10/h4-5H,1-3H2.
What are the key properties of 2-cyclobutyl-4,5-diiodopyridazin-3-one?
2-cyclobutyl-4,5-diiodopyridazin-3-one has a molecular weight of 401.97 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-4,5-diiodopyridazin-3-one is sourced from PubChem (CID 99983573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).