About (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine
(1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine (PubChem CID 99985490) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine.
Analyze (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine?
The IUPAC name of (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine (CID 99985490) is (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine.
What is the SMILES notation for (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine?
The canonical SMILES for (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine is C[C@]12CC[C@@H]3[C@@]1(C)C[C@]32N.
What is the InChIKey of (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine?
The InChIKey is IWSDYIJCXJOFIR-HXFLIBJXSA-N. The full InChI is InChI=1S/C9H15N/c1-7-5-9(10)6(7)3-4-8(7,9)2/h6H,3-5,10H2,1-2H3/t6-,7-,8+,9+/m1/s1.
What are the key properties of (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine?
(1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine has a molecular weight of 137.23 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S,5R,6R)-2,6-dimethyltricyclo[3.2.0.02,6]heptan-1-amine is sourced from PubChem (CID 99985490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).