C16H26N2O5S — CID 99986315
2-[[(2R)-1-methoxypropan-2-yl]amino]-5-(pentylsulfamoyl)benzoic acid (PubChem CID 99986315) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-[[(2R)-1-methoxypropan-2-yl]amino]-5-(pentylsulfamoyl)benzoic acid.
| Compound Name | 2-[[(2R)-1-methoxypropan-2-yl]amino]-5-(pentylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99986315 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-[[(2R)-1-methoxypropan-2-yl]amino]-5-(pentylsulfamoyl)benzoic acid |
| SMILES | CCCCCNS(=O)(=O)c1ccc(N[C@H](C)COC)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H26N2O5S/c1-4-5-6-9-17-24(21,22)13-7-8-15(14(10-13)16(19)20)18-12(2)11-23-3/h7-8,10,12,17-18H,4-6,9,11H2,1-3H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | ADSOKEOMCNNZFH-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|