C12H17N3O — CID 99986873
(3S,4R)-4-(4-aminophenyl)-1-methylpyrrolidine-3-carboxamide (PubChem CID 99986873) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is (3S,4R)-4-(4-aminophenyl)-1-methylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-4-(4-aminophenyl)-1-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 99986873 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (3S,4R)-4-(4-aminophenyl)-1-methylpyrrolidine-3-carboxamide |
| SMILES | CN1C[C@@H](C(N)=O)[C@H](c2ccc(N)cc2)C1 |
| InChI | InChI=1S/C12H17N3O/c1-15-6-10(11(7-15)12(14)16)8-2-4-9(13)5-3-8/h2-5,10-11H,6-7,13H2,1H3,(H2,14,16)/t10-,11+/m0/s1 |
| InChIKey | YCCOQNRQQQVWEX-WDEREUQCSA-N |
| XLogP | 0.40 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|