C14H16O4 — CID 99987123
(8S)-8-(2-methylpropyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one (PubChem CID 99987123) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (8S)-8-(2-methylpropyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one.
| Compound Name | (8S)-8-(2-methylpropyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
|---|---|
| PubChem CID | 99987123 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (8S)-8-(2-methylpropyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
| SMILES | CC(C)C[C@H]1CC(=O)Oc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C14H16O4/c1-8(2)3-9-4-14(15)18-11-6-13-12(5-10(9)11)16-7-17-13/h5-6,8-9H,3-4,7H2,1-2H3/t9-/m0/s1 |
| InChIKey | JTGNKUMJBMWCLH-VIFPVBQESA-N |
| XLogP | 2.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|