C23H16O7S — CID 99987156
(10R)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-10-thiophen-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 99987156) has the molecular formula C23H16O7S and a molecular weight of 436.44 g/mol. Its IUPAC name is (10R)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-10-thiophen-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-10-thiophen-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 99987156 |
| Molecular Formula | C23H16O7S |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | (10R)-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-10-thiophen-3-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc4c(c3o2)[C@H](c2ccsc2)CC(=O)O4)cc1O |
| InChI | InChI=1S/C23H16O7S/c1-28-17-3-2-11(6-14(17)24)18-8-15(25)22-16(26)9-19-21(23(22)30-18)13(7-20(27)29-19)12-4-5-31-10-12/h2-6,8-10,13,24,26H,7H2,1H3/t13-/m0/s1 |
| InChIKey | HHLNLDQUCMUJNT-ZDUSSCGKSA-N |
| XLogP | 4.38 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|