C16H18O4 — CID 99987323
(8S)-8-cyclohexyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one (PubChem CID 99987323) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (8S)-8-cyclohexyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one.
| Compound Name | (8S)-8-cyclohexyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
|---|---|
| PubChem CID | 99987323 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (8S)-8-cyclohexyl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
| SMILES | O=C1C[C@@H](C2CCCCC2)c2cc3c(cc2O1)OCO3 |
| InChI | InChI=1S/C16H18O4/c17-16-7-11(10-4-2-1-3-5-10)12-6-14-15(19-9-18-14)8-13(12)20-16/h6,8,10-11H,1-5,7,9H2/t11-/m0/s1 |
| InChIKey | HLDMNXGVNMYMCK-NSHDSACASA-N |
| XLogP | 3.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|