C12H14N2O — CID 99988035
[1-[(2-methylphenyl)methyl]pyrazol-3-yl]methanol (PubChem CID 99988035) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is [1-[(2-methylphenyl)methyl]pyrazol-3-yl]methanol.
| Compound Name | [1-[(2-methylphenyl)methyl]pyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 99988035 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | [1-[(2-methylphenyl)methyl]pyrazol-3-yl]methanol |
| SMILES | Cc1ccccc1Cn1ccc(CO)n1 |
| InChI | InChI=1S/C12H14N2O/c1-10-4-2-3-5-11(10)8-14-7-6-12(9-15)13-14/h2-7,15H,8-9H2,1H3 |
| InChIKey | YSQCNVVNQJFTJD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |