About 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one
5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one (PubChem CID 99989118) has the molecular formula C7H11NO3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one.
Molecular Properties
| Compound Name | 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one |
| PubChem CID | 99989118 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one |
| SMILES | CN1C2(CCC2)C(=O)CS1(=O)=O |
| InChI | InChI=1S/C7H11NO3S/c1-8-7(3-2-4-7)6(9)5-12(8,10)11/h2-5H2,1H3 |
| InChIKey | VUMIXANUTKZFQL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one?
The IUPAC name of 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one (CID 99989118) is 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one.
What is the SMILES notation for 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one?
The canonical SMILES for 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one is CN1C2(CCC2)C(=O)CS1(=O)=O.
What is the InChIKey of 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one?
The InChIKey is VUMIXANUTKZFQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3S/c1-8-7(3-2-4-7)6(9)5-12(8,10)11/h2-5H2,1H3.
What are the key properties of 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one?
5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one has a molecular weight of 189.24 g/mol, XLogP of -0.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6,6-dioxo-6λ6-thia-5-azaspiro[3.4]octan-8-one is sourced from PubChem (CID 99989118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).