About 3-aminothieno[3,2-c]pyridine-2-carboxamide
3-aminothieno[3,2-c]pyridine-2-carboxamide (PubChem CID 99989633) has the molecular formula C8H7N3OS
and a molecular weight of 193.23 g/mol. Its IUPAC name is 3-aminothieno[3,2-c]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-aminothieno[3,2-c]pyridine-2-carboxamide |
| PubChem CID | 99989633 |
| Molecular Formula | C8H7N3OS |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 3-aminothieno[3,2-c]pyridine-2-carboxamide |
| SMILES | NC(=O)c1sc2ccncc2c1N |
| InChI | InChI=1S/C8H7N3OS/c9-6-4-3-11-2-1-5(4)13-7(6)8(10)12/h1-3H,9H2,(H2,10,12) |
| InChIKey | TZGGCGCTVIULSI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-aminothieno[3,2-c]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminothieno[3,2-c]pyridine-2-carboxamide?
The IUPAC name of 3-aminothieno[3,2-c]pyridine-2-carboxamide (CID 99989633) is 3-aminothieno[3,2-c]pyridine-2-carboxamide.
What is the SMILES notation for 3-aminothieno[3,2-c]pyridine-2-carboxamide?
The canonical SMILES for 3-aminothieno[3,2-c]pyridine-2-carboxamide is NC(=O)c1sc2ccncc2c1N.
What is the InChIKey of 3-aminothieno[3,2-c]pyridine-2-carboxamide?
The InChIKey is TZGGCGCTVIULSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3OS/c9-6-4-3-11-2-1-5(4)13-7(6)8(10)12/h1-3H,9H2,(H2,10,12).
What are the key properties of 3-aminothieno[3,2-c]pyridine-2-carboxamide?
3-aminothieno[3,2-c]pyridine-2-carboxamide has a molecular weight of 193.23 g/mol, XLogP of 0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminothieno[3,2-c]pyridine-2-carboxamide is sourced from PubChem (CID 99989633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).