C20H25FN4O — CID 99989836
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(4-fluorophenyl)-1H-pyrazole-4-carboxamide (PubChem CID 99989836) has the molecular formula C20H25FN4O and a molecular weight of 356.44 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(4-fluorophenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(4-fluorophenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 99989836 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(4-fluorophenyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCN2CCCC[C@H]12)c1cn[nH]c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN4O/c21-16-8-6-14(7-9-16)19-17(13-23-24-19)20(26)22-12-15-4-3-11-25-10-2-1-5-18(15)25/h6-9,13,15,18H,1-5,10-12H2,(H,22,26)(H,23,24)/t15-,18+/m0/s1 |
| InChIKey | HWTXLLNFEDCTJC-MAUKXSAKSA-N |
| XLogP | 3.21 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |