ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate

C18H25NO3 — CID 99990884

IUPACethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate
SMILESCCC[C@@H](C)Oc1ccc2c(c1)c(C(=O)OCC)c(C)n2C
InChIInChI=1S/C18H25NO3/c1-6-8-12(3)22-14-9-10-16-15(11-14)17(13(4)19(16)5)18(20)21-7-2/h9-12H,6-8H2,1-5H3/t12-/m1/s1
InChIKeyRARWVEGPLLAYPP-GFCCVEGCSA-N
MW303.40 g/mol
LogP4.23
Rot. Bonds6

About ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate

ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate (PubChem CID 99990884) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate.

Molecular Properties

Compound Nameethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate
PubChem CID99990884
Molecular FormulaC18H25NO3
Molecular Weight303.40 g/mol
Exact Mass303.18
IUPAC Nameethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate
SMILESCCC[C@@H](C)Oc1ccc2c(c1)c(C(=O)OCC)c(C)n2C
InChIInChI=1S/C18H25NO3/c1-6-8-12(3)22-14-9-10-16-15(11-14)17(13(4)19(16)5)18(20)21-7-2/h9-12H,6-8H2,1-5H3/t12-/m1/s1
InChIKeyRARWVEGPLLAYPP-GFCCVEGCSA-N
XLogP4.23
TPSA40.46 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.40
LogP ≤ 54.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate?
The IUPAC name of ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate (CID 99990884) is ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate.
What is the SMILES notation for ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate?
The canonical SMILES for ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate is CCC[C@@H](C)Oc1ccc2c(c1)c(C(=O)OCC)c(C)n2C.
What is the InChIKey of ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate?
The InChIKey is RARWVEGPLLAYPP-GFCCVEGCSA-N. The full InChI is InChI=1S/C18H25NO3/c1-6-8-12(3)22-14-9-10-16-15(11-14)17(13(4)19(16)5)18(20)21-7-2/h9-12H,6-8H2,1-5H3/t12-/m1/s1.
What are the key properties of ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate?
ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate has a molecular weight of 303.40 g/mol, XLogP of 4.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,2-dimethyl-5-[(2R)-pentan-2-yl]oxyindole-3-carboxylate is sourced from PubChem (CID 99990884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).