C10H20N2O — CID 99991019
1-[(2R,3S,5S,6R)-2,3,5,6-tetramethylpiperazin-1-yl]ethanone (PubChem CID 99991019) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-[(2R,3S,5S,6R)-2,3,5,6-tetramethylpiperazin-1-yl]ethanone.
| Compound Name | 1-[(2R,3S,5S,6R)-2,3,5,6-tetramethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 99991019 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-[(2R,3S,5S,6R)-2,3,5,6-tetramethylpiperazin-1-yl]ethanone |
| SMILES | CC(=O)N1[C@H](C)[C@H](C)N[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C10H20N2O/c1-6-8(3)12(10(5)13)9(4)7(2)11-6/h6-9,11H,1-5H3/t6-,7-,8+,9+/m0/s1 |
| InChIKey | VSXCRGOTCLUJJF-RBXMUDONSA-N |
| XLogP | 0.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |