C18H22O2 — CID 99992362
(1S,3R,4S)-1,7,7-trimethyl-3-(4-methylbenzoyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 99992362) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S,3R,4S)-1,7,7-trimethyl-3-(4-methylbenzoyl)bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3R,4S)-1,7,7-trimethyl-3-(4-methylbenzoyl)bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 99992362 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (1S,3R,4S)-1,7,7-trimethyl-3-(4-methylbenzoyl)bicyclo[2.2.1]heptan-2-one |
| SMILES | Cc1ccc(C(=O)[C@@H]2C(=O)[C@@]3(C)CC[C@@H]2C3(C)C)cc1 |
| InChI | InChI=1S/C18H22O2/c1-11-5-7-12(8-6-11)15(19)14-13-9-10-18(4,16(14)20)17(13,2)3/h5-8,13-14H,9-10H2,1-4H3/t13-,14+,18+/m0/s1 |
| InChIKey | CBJIKKHQXWOTES-PMUMKWKESA-N |
| XLogP | 3.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|