C21H14O7 — CID 99993432
2-[5-[(8S)-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]furan-2-yl]benzoic acid (PubChem CID 99993432) has the molecular formula C21H14O7 and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-[5-[(8S)-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(8S)-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 99993432 |
| Molecular Formula | C21H14O7 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-[5-[(8S)-6-oxo-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-8-yl]furan-2-yl]benzoic acid |
| SMILES | O=C1C[C@H](c2ccc(-c3ccccc3C(=O)O)o2)c2cc3c(cc2O1)OCO3 |
| InChI | InChI=1S/C21H14O7/c22-20-8-14(13-7-18-19(26-10-25-18)9-17(13)28-20)16-6-5-15(27-16)11-3-1-2-4-12(11)21(23)24/h1-7,9,14H,8,10H2,(H,23,24)/t14-/m0/s1 |
| InChIKey | VWMHHAVNXDHBEC-AWEZNQCLSA-N |
| XLogP | 3.81 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|