C20H20N2O4 — CID 99994306
(9R)-2-propan-2-ylidene-9-(2-propan-2-ylpyrazol-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 99994306) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (9R)-2-propan-2-ylidene-9-(2-propan-2-ylpyrazol-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (9R)-2-propan-2-ylidene-9-(2-propan-2-ylpyrazol-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 99994306 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (9R)-2-propan-2-ylidene-9-(2-propan-2-ylpyrazol-3-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | CC(C)=C1Oc2c(ccc3c2[C@H](c2ccnn2C(C)C)CC(=O)O3)C1=O |
| InChI | InChI=1S/C20H20N2O4/c1-10(2)19-18(24)12-5-6-15-17(20(12)26-19)13(9-16(23)25-15)14-7-8-21-22(14)11(3)4/h5-8,11,13H,9H2,1-4H3/t13-/m0/s1 |
| InChIKey | AMNYBHKTAIPKHN-ZDUSSCGKSA-N |
| XLogP | 3.77 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|